CAS 1368794-39-1 appears in our catalog under these names: 7-Bromo-4-methyl-1h,2h,3h,4h-pyrido[2,3-b]pyrazin-2-one, 95, 7-Bromo-4-methyl-1h,2h,3h,4h-pyrido(2,3-b)pyrazin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
7-bromo-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one (CAS 1368794-39-1) is a chemical compound with the molecular formula C8H8BrN3O and a molecular weight of 242.07 g/mol. IUPAC name: 7-bromo-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one. InChIKey: QAMUOBSXKFQRQC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3O |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 7-bromo-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| InChIKey | QAMUOBSXKFQRQC-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C1N=CC(=C2)Br |
Computed by PubChem (NCBI)