CAS 1782574-28-0 is the registry number for 6-Bromo-8-methoxy-2-methylimidazo[1,2-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-methoxy-2-methylimidazo[1,2-a]pyrazine (CAS 1782574-28-0) is a chemical compound with the molecular formula C8H8BrN3O and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-8-methoxy-2-methylimidazo[1,2-a]pyrazine. InChIKey: XCZLICPMJUBLEU-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3O |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-8-methoxy-2-methylimidazo[1,2-a]pyrazine |
| InChIKey | XCZLICPMJUBLEU-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C(C2=N1)OC)Br |
Computed by PubChem (NCBI)