CAS 1368799-14-7 appears in our catalog under these names: 5-Fluoro-2-oxo-2,3-dihydrobenzo[d]oxazole-6-sulfonyl chloride, 95%, 5-Fluoro-2-oxo-2,3-dihydrobenzo(d)oxazole-6-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride (CAS 1368799-14-7) is a chemical compound with the molecular formula C7H3ClFNO4S and a molecular weight of 251.62 g/mol. IUPAC name: 5-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride. InChIKey: AVWYCZNTEYZBFK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4S |
|---|---|
| Molecular weight | 251.62 g/mol |
| IUPAC name | 5-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride |
| InChIKey | AVWYCZNTEYZBFK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)S(=O)(=O)Cl)OC(=O)N2 |
Computed by PubChem (NCBI)