CAS 2251113-44-5 is the registry number for 7-Fluoro-2-oxo-2,3-dihydrobenzo[d]oxazole-6-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride (CAS 2251113-44-5) is a chemical compound with the molecular formula C7H3ClFNO4S and a molecular weight of 251.62 g/mol. IUPAC name: 7-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride. InChIKey: JEZIYODETAMDAZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4S |
|---|---|
| Molecular weight | 251.62 g/mol |
| IUPAC name | 7-fluoro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride |
| InChIKey | JEZIYODETAMDAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=O)O2)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)