Products 1368895-64-0
CAS 1368895-64-0 is the registry number for 5-(Hydroxymethyl)-3,3-dimethyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(hydroxymethyl)-3,3-dimethyl-1H-indol-2-one (CAS 1368895-64-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5-(hydroxymethyl)-3,3-dimethyl-1H-indol-2-one. InChIKey: CCRHJRFNRKIETR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-(hydroxymethyl)-3,3-dimethyl-1H-indol-2-one |
| InChIKey | CCRHJRFNRKIETR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)CO)NC1=O)C |
Computed by PubChem (NCBI)