CAS 1368955-44-5 is the registry number for 1-Ethoxy-2,5-dimethyl-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-ethoxy-2,5-dimethyl-4-nitrobenzene (CAS 1368955-44-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-ethoxy-2,5-dimethyl-4-nitrobenzene. InChIKey: YKUJJKQXKVCRDQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-ethoxy-2,5-dimethyl-4-nitrobenzene |
| InChIKey | YKUJJKQXKVCRDQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)