Products 1369088-95-8
CAS 1369088-95-8 is the registry number for 2-(4-(2,2-Dimethylpropyl)-1H-pyrazol-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4-(2,2-dimethylpropyl)-1H-pyrazol-5-yl]acetic acid (CAS 1369088-95-8) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 2-[4-(2,2-dimethylpropyl)-1H-pyrazol-5-yl]acetic acid. InChIKey: LOYKGRBQQYRGNT-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 2-[4-(2,2-dimethylpropyl)-1H-pyrazol-5-yl]acetic acid |
| InChIKey | LOYKGRBQQYRGNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC1=C(NN=C1)CC(=O)O |
Computed by PubChem (NCBI)