CAS 1369135-69-2 appears in our catalog under these names: 2-Bromo-6,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole, 2-Bromo-6,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-bromo-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole (CAS 1369135-69-2) is a chemical compound with the molecular formula C9H12BrNS and a molecular weight of 246.17 g/mol. IUPAC name: 2-bromo-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole. InChIKey: WFTILCWJUXYCIR-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNS |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 2-bromo-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole |
| InChIKey | WFTILCWJUXYCIR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)SC(=N2)Br)C |
Computed by PubChem (NCBI)