CAS 1803604-58-1 is the registry number for (1-(5-Bromothiophen-2-yl)cyclobutyl)methanamine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[1-(5-bromothiophen-2-yl)cyclobutyl]methanamine (CAS 1803604-58-1) is a chemical compound with the molecular formula C9H12BrNS and a molecular weight of 246.17 g/mol. IUPAC name: [1-(5-bromothiophen-2-yl)cyclobutyl]methanamine. InChIKey: CAMGMECCFOKPBE-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNS |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | [1-(5-bromothiophen-2-yl)cyclobutyl]methanamine |
| InChIKey | CAMGMECCFOKPBE-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)