CAS 1369140-70-4 is the registry number for 4-Bromo-1,1-dimethylisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3,3-dimethyl-1,2-dihydroisoindole (CAS 1369140-70-4) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 7-bromo-3,3-dimethyl-1,2-dihydroisoindole. InChIKey: XUPPWEHXBVKPJF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 7-bromo-3,3-dimethyl-1,2-dihydroisoindole |
| InChIKey | XUPPWEHXBVKPJF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CN1)C(=CC=C2)Br)C |
Computed by PubChem (NCBI)