CAS 1369205-80-0 is the registry number for 3-Propionylphenyl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-propanoylphenyl) 4-methylbenzenesulfonate (CAS 1369205-80-0) is a chemical compound with the molecular formula C16H16O4S and a molecular weight of 304.4 g/mol. IUPAC name: (3-propanoylphenyl) 4-methylbenzenesulfonate. InChIKey: IVXDUQGHDQJFPP-UHFFFAOYSA-N.
| Molecular formula | C16H16O4S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (3-propanoylphenyl) 4-methylbenzenesulfonate |
| InChIKey | IVXDUQGHDQJFPP-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=CC=C1)OS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)