Products 1369205-80-0

CAS 1369205-80-0 is the registry number for 3-Propionylphenyl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-propanoylphenyl) 4-methylbenzenesulfonate (CAS 1369205-80-0) is a chemical compound with the molecular formula C16H16O4S and a molecular weight of 304.4 g/mol. IUPAC name: (3-propanoylphenyl) 4-methylbenzenesulfonate. InChIKey: IVXDUQGHDQJFPP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O4S
Molecular weight304.4 g/mol
IUPAC name(3-propanoylphenyl) 4-methylbenzenesulfonate
InChIKeyIVXDUQGHDQJFPP-UHFFFAOYSA-N
SMILESCCC(=O)C1=CC(=CC=C1)OS(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)