Products 85257-88-1
CAS 85257-88-1 is the registry number for 4-Acetyl-2-methylphenyl 4-methylbenzenesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(4-acetyl-2-methylphenyl) 4-methylbenzenesulfonate (CAS 85257-88-1) is a chemical compound with the molecular formula C16H16O4S and a molecular weight of 304.4 g/mol. IUPAC name: (4-acetyl-2-methylphenyl) 4-methylbenzenesulfonate. InChIKey: BHHMZPUPJJKNNA-UHFFFAOYSA-N.
| Molecular formula | C16H16O4S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (4-acetyl-2-methylphenyl) 4-methylbenzenesulfonate |
| InChIKey | BHHMZPUPJJKNNA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)C(=O)C)C |
Computed by PubChem (NCBI)