CAS 1369366-52-8 is the registry number for 6-Aminochroman-8-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-3,4-dihydro-2H-chromen-8-ol (CAS 1369366-52-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 6-amino-3,4-dihydro-2H-chromen-8-ol. InChIKey: JZDSFEBTNGJYQH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 6-amino-3,4-dihydro-2H-chromen-8-ol |
| InChIKey | JZDSFEBTNGJYQH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)N)O)OC1 |
Computed by PubChem (NCBI)