CAS 75456-80-3 appears in our catalog under these names: 2-Amino-3,3-difluoro-3-phenyl-1-propanol, 95%, beta-Amino-gamma,gamma-difluoro-benzenepropanol. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 2,5g.
2-amino-3,3-difluoro-3-phenylpropan-1-ol (CAS 75456-80-3) is a chemical compound with the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. IUPAC name: 2-amino-3,3-difluoro-3-phenylpropan-1-ol. InChIKey: CBOLUWLXNCPXRF-UHFFFAOYSA-N.
| Molecular formula | C9H11F2NO |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-amino-3,3-difluoro-3-phenylpropan-1-ol |
| InChIKey | CBOLUWLXNCPXRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(CO)N)(F)F |
Computed by PubChem (NCBI)