Products 1369414-48-1

CAS 1369414-48-1 is the registry number for 2-Isobutoxy-3,5-dimethylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,5-dimethyl-2-(2-methylpropoxy)benzoic acid (CAS 1369414-48-1) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3,5-dimethyl-2-(2-methylpropoxy)benzoic acid. InChIKey: SPEWYLGISZPTPA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC name3,5-dimethyl-2-(2-methylpropoxy)benzoic acid
InChIKeySPEWYLGISZPTPA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C(=O)O)OCC(C)C)C

Computed by PubChem (NCBI)