Products 1369529-80-5
CAS 1369529-80-5 is the registry number for (1S,2S)-N1,N1-Dibenzylcyclohexane-1,2-Diamine, 97%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 500mg.
Trans-(1S,2S)-2-N,2-N-dibenzylcyclohexane-1,2-diamine (CAS 1369529-80-5) is a chemical compound with the molecular formula C20H26N2 and a molecular weight of 294.4 g/mol. IUPAC name: trans-(1S,2S)-2-N,2-N-dibenzylcyclohexane-1,2-diamine. InChIKey: SXCIGPQHVCQIFJ-PMACEKPBSA-N.
| Molecular formula | C20H26N2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | trans-(1S,2S)-2-N,2-N-dibenzylcyclohexane-1,2-diamine |
| InChIKey | SXCIGPQHVCQIFJ-PMACEKPBSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)N(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)