CAS 593284-15-2 appears in our catalog under these names: (1R,2R)-N1,N1-Dibenzylcyclohexane-1,2-diamine, 95%, 95%, (1R,2R)-N1,N1-Dibenzylcyclohexane-1,2-diamine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg.
Trans-(1R,2R)-2-N,2-N-dibenzylcyclohexane-1,2-diamine (CAS 593284-15-2) is a chemical compound with the molecular formula C20H26N2 and a molecular weight of 294.4 g/mol. IUPAC name: trans-(1R,2R)-2-N,2-N-dibenzylcyclohexane-1,2-diamine. InChIKey: SXCIGPQHVCQIFJ-WOJBJXKFSA-N.
| Molecular formula | C20H26N2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-N,2-N-dibenzylcyclohexane-1,2-diamine |
| InChIKey | SXCIGPQHVCQIFJ-WOJBJXKFSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)N(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)