CAS 1369588-00-0 is the registry number for O-Ethyl Chlorthalidone Hydrate. Offered by: TRC, Biosynth. Available pack sizes: 500mg.
2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide (CAS 1369588-00-0) is a chemical compound with the molecular formula C16H15ClN2O4S and a molecular weight of 366.8 g/mol. IUPAC name: 2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide. InChIKey: XAYIDIRKYMLVTP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O4S |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide |
| InChIKey | XAYIDIRKYMLVTP-UHFFFAOYSA-N |
| SMILES | CCOC1(C2=CC=CC=C2C(=O)N1)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)