CAS 1369995-36-7 appears in our catalog under these names: Chlortalidone (Chlorthalidone) EP Impurity D, Chlortalidone EP Impurity D, 2-Chloro-5-(1-ethoxy-3-oxoisoindolin-1-yl)benzenesulfonamide, Chlorthalidone impurity 3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 25mg, Get quote.
2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide (CAS 1369995-36-7) is a chemical compound with the molecular formula C16H15ClN2O4S and a molecular weight of 366.8 g/mol. IUPAC name: 2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide. InChIKey: XAYIDIRKYMLVTP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O4S |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 2-chloro-5-(1-ethoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide |
| InChIKey | XAYIDIRKYMLVTP-UHFFFAOYSA-N |
| SMILES | CCOC1(C2=CC=CC=C2C(=O)N1)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)