CAS 1369829-80-0 appears in our catalog under these names: 1-Bromo-4-tert-butyl-2-fluorobenzene, 1-Bromo-4-(tert-butyl)-2-fluorobenzene, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
1-bromo-4-tert-butyl-2-fluorobenzene (CAS 1369829-80-0) is a chemical compound with the molecular formula C10H12BrF and a molecular weight of 231.10 g/mol. IUPAC name: 1-bromo-4-tert-butyl-2-fluorobenzene. InChIKey: SYOOUBIFOOVLMY-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 1-bromo-4-tert-butyl-2-fluorobenzene |
| InChIKey | SYOOUBIFOOVLMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)