Products 2166027-03-6
CAS 2166027-03-6 is the registry number for 2-(1-bromoethyl)-1-fluoro-3,4-dimethyl-benzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(1-bromoethyl)-1-fluoro-3,4-dimethylbenzene (CAS 2166027-03-6) is a chemical compound with the molecular formula C10H12BrF and a molecular weight of 231.10 g/mol. IUPAC name: 2-(1-bromoethyl)-1-fluoro-3,4-dimethylbenzene. InChIKey: RYXMJMCHXHXMIY-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2-(1-bromoethyl)-1-fluoro-3,4-dimethylbenzene |
| InChIKey | RYXMJMCHXHXMIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(C)Br)C |
Computed by PubChem (NCBI)