CAS 1369853-99-5 is the registry number for 4-Iodo-1-isopropoxy-2-isopropylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-iodo-2-propan-2-yl-1-propan-2-yloxybenzene (CAS 1369853-99-5) is a chemical compound with the molecular formula C12H17IO and a molecular weight of 304.17 g/mol. IUPAC name: 4-iodo-2-propan-2-yl-1-propan-2-yloxybenzene. InChIKey: GESDODUIGZYLNV-UHFFFAOYSA-N.
| Molecular formula | C12H17IO |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | 4-iodo-2-propan-2-yl-1-propan-2-yloxybenzene |
| InChIKey | GESDODUIGZYLNV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)I)OC(C)C |
Computed by PubChem (NCBI)