CAS 870007-40-2 appears in our catalog under these names: 4-(tert-Butyl)-2-ethoxy-1-iodobenzene, 95%, 4-(tert-butyl)-2-ethoxy-1-iodobenzene, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-tert-butyl-2-ethoxy-1-iodobenzene (CAS 870007-40-2) is a chemical compound with the molecular formula C12H17IO and a molecular weight of 304.17 g/mol. IUPAC name: 4-tert-butyl-2-ethoxy-1-iodobenzene. InChIKey: GWLABQRIJQCIBU-UHFFFAOYSA-N.
| Molecular formula | C12H17IO |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | 4-tert-butyl-2-ethoxy-1-iodobenzene |
| InChIKey | GWLABQRIJQCIBU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(C)(C)C)I |
Computed by PubChem (NCBI)