Products 1369936-23-1
CAS 1369936-23-1 is the registry number for 1-(tert-Butoxy)-2-methoxy-4-methylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-4-methyl-1-[(2-methylpropan-2-yl)oxy]benzene (CAS 1369936-23-1) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 2-methoxy-4-methyl-1-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: ARGILXCVIBVDNB-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 2-methoxy-4-methyl-1-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | ARGILXCVIBVDNB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(C)(C)C)OC |
Computed by PubChem (NCBI)