Products 1369938-52-2
CAS 1369938-52-2 is the registry number for 1-Iodo-3-isopropoxy-5-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-iodo-3-propan-2-yloxy-5-(trifluoromethyl)benzene (CAS 1369938-52-2) is a chemical compound with the molecular formula C10H10F3IO and a molecular weight of 330.08 g/mol. IUPAC name: 1-iodo-3-propan-2-yloxy-5-(trifluoromethyl)benzene. InChIKey: YPRJPIJIXMMPBD-UHFFFAOYSA-N.
| Molecular formula | C10H10F3IO |
|---|---|
| Molecular weight | 330.08 g/mol |
| IUPAC name | 1-iodo-3-propan-2-yloxy-5-(trifluoromethyl)benzene |
| InChIKey | YPRJPIJIXMMPBD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)C(F)(F)F)I |
Computed by PubChem (NCBI)