CAS 887144-97-0 appears in our catalog under these names: 3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole, 98%, Togni’s Reagent, 3,3–Dimethyl–1–(trifluoromethyl)–1,2–benziodoxole, 1-Trifluoromethyl-3,3-dimethyl-1,2-benziodoxole, >97.0%(HPLC), 3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole, 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Thermo Scientific (Acros). Available pack sizes: 5g, 25g, 10g, 1g, 250MG, 15g, 100g, 250g.
3,3-dimethyl-1-(trifluoromethyl)-1lambda3,2-benziodoxole (CAS 887144-97-0) is a chemical compound with the molecular formula C10H10F3IO and a molecular weight of 330.08 g/mol. IUPAC name: 3,3-dimethyl-1-(trifluoromethyl)-1lambda3,2-benziodoxole. InChIKey: HVAPLSNCVYXFDQ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3IO |
|---|---|
| Molecular weight | 330.08 g/mol |
| IUPAC name | 3,3-dimethyl-1-(trifluoromethyl)-1lambda3,2-benziodoxole |
| InChIKey | HVAPLSNCVYXFDQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2I(O1)C(F)(F)F)C |
Computed by PubChem (NCBI)