Products 1369963-51-8
CAS 1369963-51-8 is the registry number for AP-6, 99.84%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg, 100 mg.
2-[3-(4-amino-2-pyridinyl)phenyl]pyridin-4-amine (CAS 1369963-51-8) is a chemical compound with the molecular formula C16H14N4 and a molecular weight of 262.31 g/mol. IUPAC name: 2-[3-(4-amino-2-pyridinyl)phenyl]pyridin-4-amine. InChIKey: XLXGLQRJMSGVPH-UHFFFAOYSA-N.
| Molecular formula | C16H14N4 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 2-[3-(4-amino-2-pyridinyl)phenyl]pyridin-4-amine |
| InChIKey | XLXGLQRJMSGVPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CC(=C2)N)C3=NC=CC(=C3)N |
Computed by PubChem (NCBI)