CAS 59447-35-7 is the registry number for 4,4′-(2,6-Pyrazinediyl)bis[benzenamine], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[6-(4-aminophenyl)pyrazin-2-yl]aniline (CAS 59447-35-7) is a chemical compound with the molecular formula C16H14N4 and a molecular weight of 262.31 g/mol. IUPAC name: 4-[6-(4-aminophenyl)pyrazin-2-yl]aniline. InChIKey: MTABUIPYQHVVCV-UHFFFAOYSA-N.
| Molecular formula | C16H14N4 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 4-[6-(4-aminophenyl)pyrazin-2-yl]aniline |
| InChIKey | MTABUIPYQHVVCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=N2)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)