CAS 1369969-44-7 appears in our catalog under these names: Rivaroxaban Impurity 27, Rivaroxaban Impurity N, Rivaroxaban Impurity 33, 2-((2S)-2-Hydroxy-3-((4-(3-oxo-4-morpholinyl)phenyl)amino)propyl)-1H-isoindole-1,3(2H)-dione. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione (CAS 1369969-44-7) is a chemical compound with the molecular formula C21H21N3O5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione. InChIKey: CKFVSMPWXAASIQ-INIZCTEOSA-N.
| Molecular formula | C21H21N3O5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[(2S)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione |
| InChIKey | CKFVSMPWXAASIQ-INIZCTEOSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@@H](CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)