Products 2599284-47-4
CAS 2599284-47-4 is the registry number for Roxadustat Impurity 87. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid (CAS 2599284-47-4) is a chemical compound with the molecular formula C21H21N3O5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[[1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid. InChIKey: BRRGUPOHOWABRY-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[[1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid |
| InChIKey | BRRGUPOHOWABRY-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)O)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)