Products 137-48-4

CAS 137-48-4 is the registry number for 2-Nitrochlorobenzene-4-sulfomethyl amide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-N-methyl-3-nitrobenzenesulfonamide (CAS 137-48-4) is a chemical compound with the molecular formula C7H7ClN2O4S and a molecular weight of 250.66 g/mol. IUPAC name: 4-chloro-N-methyl-3-nitrobenzenesulfonamide. InChIKey: UMNGEAKUUOJPAX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClN2O4S
Molecular weight250.66 g/mol
IUPAC name4-chloro-N-methyl-3-nitrobenzenesulfonamide
InChIKeyUMNGEAKUUOJPAX-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)