CAS 137-48-4 is the registry number for 2-Nitrochlorobenzene-4-sulfomethyl amide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-chloro-N-methyl-3-nitrobenzenesulfonamide (CAS 137-48-4) is a chemical compound with the molecular formula C7H7ClN2O4S and a molecular weight of 250.66 g/mol. IUPAC name: 4-chloro-N-methyl-3-nitrobenzenesulfonamide. InChIKey: UMNGEAKUUOJPAX-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O4S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 4-chloro-N-methyl-3-nitrobenzenesulfonamide |
| InChIKey | UMNGEAKUUOJPAX-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)