CAS 944128-99-8 is the registry number for Methyl 2-chloro-6-(methylsulfonyl)pyrimidine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-6-methylsulfonylpyrimidine-4-carboxylate (CAS 944128-99-8) is a chemical compound with the molecular formula C7H7ClN2O4S and a molecular weight of 250.66 g/mol. IUPAC name: methyl 2-chloro-6-methylsulfonylpyrimidine-4-carboxylate. InChIKey: IDQSKSUVAPYRIN-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O4S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | methyl 2-chloro-6-methylsulfonylpyrimidine-4-carboxylate |
| InChIKey | IDQSKSUVAPYRIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=N1)Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)