CAS 137023-78-0 is the registry number for 4,5-Diethylphthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-diethylphthalic acid (CAS 137023-78-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 4,5-diethylphthalic acid. InChIKey: NBPRDQJBFUACFV-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4,5-diethylphthalic acid |
| InChIKey | NBPRDQJBFUACFV-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1CC)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)