Products 1370337-49-7
CAS 1370337-49-7 is the registry number for N-(Adamantan-1-yl)-1H-indole-3-carboxamide, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(1-adamantyl)-1H-indole-3-carboxamide (CAS 1370337-49-7) is a chemical compound with the molecular formula C19H22N2O and a molecular weight of 294.4 g/mol. IUPAC name: N-(1-adamantyl)-1H-indole-3-carboxamide. InChIKey: USXAVHMFDXOJPO-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-(1-adamantyl)-1H-indole-3-carboxamide |
| InChIKey | USXAVHMFDXOJPO-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)