Products 1370406-84-0

CAS 1370406-84-0 is the registry number for Bis(thiazol-5-ylmethyl) Carbonate, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

Bis(1,3-thiazol-5-ylmethyl) carbonate (CAS 1370406-84-0) is a chemical compound with the molecular formula C9H8N2O3S2 and a molecular weight of 256.3 g/mol. IUPAC name: bis(1,3-thiazol-5-ylmethyl) carbonate. InChIKey: ICFSKYCTIJFSSL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O3S2
Molecular weight256.3 g/mol
IUPAC namebis(1,3-thiazol-5-ylmethyl) carbonate
InChIKeyICFSKYCTIJFSSL-UHFFFAOYSA-N
SMILESC1=C(SC=N1)COC(=O)OCC2=CN=CS2

Computed by PubChem (NCBI)