CAS 946666-76-8 is the registry number for ([(5-Oxo-5h-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetic acid (CAS 946666-76-8) is a chemical compound with the molecular formula C9H8N2O3S2 and a molecular weight of 256.3 g/mol. IUPAC name: 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetic acid. InChIKey: YBLIDSVDNAXNKL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetic acid |
| InChIKey | YBLIDSVDNAXNKL-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC(=CC(=O)N21)CSCC(=O)O |
Computed by PubChem (NCBI)