CAS 137052-25-6 is the registry number for Di-t-butyl-(15N)imidodicarbonate. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 137052-25-6) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 218.26 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: XCAQIUOFDMREBA-KHWBWMQUSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 218.26 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | XCAQIUOFDMREBA-KHWBWMQUSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH]C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)