CAS 1370597-61-7 appears in our catalog under these names: 6-[3-(3-Chloro-phenyl)-[1,2,4]oxadiazol-5-yl]-2h-pyridazin-3-one, 95%, 6-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)-2,3-dihydropyridazin-3-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one (CAS 1370597-61-7) is a chemical compound with the molecular formula C12H7ClN4O2 and a molecular weight of 274.66 g/mol. IUPAC name: 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one. InChIKey: KLMINRVAUBLYDJ-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN4O2 |
|---|---|
| Molecular weight | 274.66 g/mol |
| IUPAC name | 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one |
| InChIKey | KLMINRVAUBLYDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)C3=NNC(=O)C=C3 |
Computed by PubChem (NCBI)