CAS 448190-45-2 appears in our catalog under these names: 3-(2H-1,3-Benzodioxol-5-yl)-6-chloro-(1,2,4)triazolo(4,3-b)pyridazine, 95%, 3-(1,3-Dioxaindan-5-yl)-6-chloro-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(1,3-benzodioxol-5-yl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (CAS 448190-45-2) is a chemical compound with the molecular formula C12H7ClN4O2 and a molecular weight of 274.66 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: JKNQOJFNAKGJGF-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN4O2 |
|---|---|
| Molecular weight | 274.66 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | JKNQOJFNAKGJGF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NN=C4N3N=C(C=C4)Cl |
Computed by PubChem (NCBI)