CAS 1370698-98-8 appears in our catalog under these names: N-Ethylsuccinimide-d5, 1-Ethylpyrrolidine-2,5-dione-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 50 mg, 10 mg, 25 mg.
1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione (CAS 1370698-98-8) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 132.17 g/mol. IUPAC name: 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione. InChIKey: GHAZCVNUKKZTLG-ZBJDZAJPSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 132.17 g/mol |
| IUPAC name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione |
| InChIKey | GHAZCVNUKKZTLG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C(=O)CCC1=O |
Computed by PubChem (NCBI)