Products 1371587-51-7
CAS 1371587-51-7 appears in our catalog under these names: Cavosonstat/ 98.91% (existing batch purity), Cavosonstat, Cavosonstat 98%, 3-Chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid, 98%, 98%, Cavosonstat, 99.36%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid (CAS 1371587-51-7) is a chemical compound with the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. IUPAC name: 3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid. InChIKey: BXSZILNGNMDGSL-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO3 |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | 3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid |
| InChIKey | BXSZILNGNMDGSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C2=NC3=C(C=C2)C=C(C=C3)O |
Computed by PubChem (NCBI)