CAS 890091-80-2 is the registry number for 2-(4-Chlorophenyl)indolizine 3-Glyoxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid (CAS 890091-80-2) is a chemical compound with the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid. InChIKey: AFISNAKLTPIWMH-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO3 |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid |
| InChIKey | AFISNAKLTPIWMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N2C=C1)C(=O)C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)