Products 890091-80-2

CAS 890091-80-2 is the registry number for 2-(4-Chlorophenyl)indolizine 3-Glyoxylic Acid. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid (CAS 890091-80-2) is a chemical compound with the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid. InChIKey: AFISNAKLTPIWMH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10ClNO3
Molecular weight299.71 g/mol
IUPAC name2-[2-(4-chlorophenyl)indolizin-3-yl]-2-oxoacetic acid
InChIKeyAFISNAKLTPIWMH-UHFFFAOYSA-N
SMILESC1=CC2=CC(=C(N2C=C1)C(=O)C(=O)O)C3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)