CAS 13719-49-8 is the registry number for (E)-N-benzyl-2-phenylethene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-N-benzyl-2-phenylethenesulfonamide (CAS 13719-49-8) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 273.4 g/mol. IUPAC name: (E)-N-benzyl-2-phenylethenesulfonamide. InChIKey: DGZFDOYMYOFLFI-VAWYXSNFSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | (E)-N-benzyl-2-phenylethenesulfonamide |
| InChIKey | DGZFDOYMYOFLFI-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)