CAS 1372179-40-2 is the registry number for 1-(4-Chloro-3-methylphenyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chloro-3-methylphenyl)guanidine (CAS 1372179-40-2) is a chemical compound with the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. IUPAC name: 2-(4-chloro-3-methylphenyl)guanidine. InChIKey: JIJUHARYHAYZTO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3 |
|---|---|
| Molecular weight | 183.64 g/mol |
| IUPAC name | 2-(4-chloro-3-methylphenyl)guanidine |
| InChIKey | JIJUHARYHAYZTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N=C(N)N)Cl |
Computed by PubChem (NCBI)