CAS 13722-96-8 appears in our catalog under these names: 2,4-Dihydroxy-5-nitrobenzoic acid, 95%, 2,4-Dihydroxy-5-nitrobenzoic acid, 98%, 98%, 2,4-Dihydroxy-5-nitrobenzoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
2,4-dihydroxy-5-nitrobenzoic acid (CAS 13722-96-8) is a chemical compound with the molecular formula C7H5NO6 and a molecular weight of 199.12 g/mol. IUPAC name: 2,4-dihydroxy-5-nitrobenzoic acid. InChIKey: DVHFWKCHUQZGSF-UHFFFAOYSA-N.
| Molecular formula | C7H5NO6 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | 2,4-dihydroxy-5-nitrobenzoic acid |
| InChIKey | DVHFWKCHUQZGSF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)O)C(=O)O |
Computed by PubChem (NCBI)