Products 13722-96-8

CAS 13722-96-8 appears in our catalog under these names: 2,4-Dihydroxy-5-nitrobenzoic acid, 95%, 2,4-Dihydroxy-5-nitrobenzoic acid, 98%, 98%, 2,4-Dihydroxy-5-nitrobenzoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.

2,4-dihydroxy-5-nitrobenzoic acid (CAS 13722-96-8) is a chemical compound with the molecular formula C7H5NO6 and a molecular weight of 199.12 g/mol. IUPAC name: 2,4-dihydroxy-5-nitrobenzoic acid. InChIKey: DVHFWKCHUQZGSF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NO6
Molecular weight199.12 g/mol
IUPAC name2,4-dihydroxy-5-nitrobenzoic acid
InChIKeyDVHFWKCHUQZGSF-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1[N+](=O)[O-])O)O)C(=O)O

Computed by PubChem (NCBI)