Products 84211-30-3

CAS 84211-30-3 appears in our catalog under these names: 3,4-Dihydroxy-5-nitrobenzoic Acid, >95% (HPLC), 3,4–Dihydroxy–5–nitrobenzoic Acid, 3,4-Dihydroxy-5-nitrobenzoic acid 95%, 3,4-Dihydroxy-5-Nitrobenzoic Acid, 95%, 95%, 3,4-Dihydroxy-5-nitrobenzoic acid, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 25g, 100g, 250g, 500g.

Structural formula: {0} (CAS {1})

3,4-dihydroxy-5-nitrobenzoic acid (CAS 84211-30-3) is a chemical compound with the molecular formula C7H5NO6 and a molecular weight of 199.12 g/mol. IUPAC name: 3,4-dihydroxy-5-nitrobenzoic acid. InChIKey: HDPSONAKHMNQPA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NO6
Molecular weight199.12 g/mol
IUPAC name3,4-dihydroxy-5-nitrobenzoic acid
InChIKeyHDPSONAKHMNQPA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])O)O)C(=O)O

Computed by PubChem (NCBI)