Products 1372857-79-8

CAS 1372857-79-8 is the registry number for 3-Benzyl 6-(tert-butyl) 3,6-diazabicyclo[3.1.0]hexane-3,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.1.0]hexane-3,6-dicarboxylate (CAS 1372857-79-8) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: 3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.1.0]hexane-3,6-dicarboxylate. InChIKey: QTBLSNAAGREVKG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22N2O4
Molecular weight318.4 g/mol
IUPAC name3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.1.0]hexane-3,6-dicarboxylate
InChIKeyQTBLSNAAGREVKG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2C1CN(C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)