Products 1372859-34-1
CAS 1372859-34-1 appears in our catalog under these names: (E)-3-(2-Ethoxy-4-methoxyphenyl)acrylic acid, 95%, 2-Ethoxy-4-methoxycinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
(E)-3-(2-ethoxy-4-methoxyphenyl)prop-2-enoic acid (CAS 1372859-34-1) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (E)-3-(2-ethoxy-4-methoxyphenyl)prop-2-enoic acid. InChIKey: NVUZCTOKHZEUMN-FNORWQNLSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (E)-3-(2-ethoxy-4-methoxyphenyl)prop-2-enoic acid |
| InChIKey | NVUZCTOKHZEUMN-FNORWQNLSA-N |
| SMILES | CCOC1=C(C=CC(=C1)OC)/C=C/C(=O)O |
Computed by PubChem (NCBI)