CAS 1373028-86-4 appears in our catalog under these names: cis–tert–Butyl 1–(hydroxymethyl)–3–azabicyclo(3·1·0)hexane–3–carboxylate, tert-Butyl (1s,5s)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1S,5S)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1373028-86-4) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,5S)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: BTWDGFQQIGGAPU-KCJUWKMLSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,5S)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | BTWDGFQQIGGAPU-KCJUWKMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@]2(C1)CO |
Computed by PubChem (NCBI)