Products 1373029-18-5
CAS 1373029-18-5 is the registry number for tert-Butyl 8-(hydroxymethyl)-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 8-(hydroxymethyl)-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1373029-18-5) is a chemical compound with the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. IUPAC name: tert-butyl 8-(hydroxymethyl)-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: HVUXRNDAOUSVLC-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | tert-butyl 8-(hydroxymethyl)-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | HVUXRNDAOUSVLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CCS2(=O)=O)CO |
Computed by PubChem (NCBI)